![[ICO]](/icons/blank.gif) |
Name |
Last modified |
Size |
Description |
|
|---|
 |
Parent Directory |
|
- |
|
 |
A German Spectacle |
20-Apr-2018 16:20 |
- |
|
|
ASIO ⁄ DJ HMC |
20-Apr-2018 16:20 |
- |
|
|
Acido |
20-Apr-2018 16:20 |
- |
|
|
Ad Nauseam |
20-Apr-2018 16:20 |
- |
|
|
Aetheres |
20-Apr-2018 16:20 |
- |
|
|
Ansiktet |
20-Apr-2018 16:20 |
- |
|
|
Apes of Wrath |
20-Apr-2018 16:20 |
- |
|
|
Ark Life |
20-Apr-2018 16:20 |
- |
|
|
Artem Folevski |
20-Apr-2018 16:20 |
- |
|
|
Ashbrooke All Stars |
20-Apr-2018 16:20 |
- |
|
|
Aubrey Hodges |
20-Apr-2018 16:20 |
- |
|
|
Aufklärung |
20-Apr-2018 16:20 |
- |
|
|
Axwell Ingrosso |
20-Apr-2018 16:20 |
- |
|
|
BEDlight for blueEYES |
20-Apr-2018 16:20 |
- |
|
|
Babe, Terror |
20-Apr-2018 16:20 |
- |
|
|
Baboon & Ceerre |
20-Apr-2018 16:20 |
- |
|
|
Barney Wilen & Philippe Petit |
20-Apr-2018 16:20 |
- |
|
|
Battle Axe |
20-Apr-2018 16:20 |
- |
|
|
Beethoven; Solomon, Philharmonia Orchestra, BBC Symphony Orchestra, André Cluytens, Herbert Menges, Sir Adrian Boult |
20-Apr-2018 16:20 |
- |
|
|
Bernadette Yao |
20-Apr-2018 16:20 |
- |
|
|
Bernd Reheuser |
20-Apr-2018 16:20 |
- |
|
|
Bill Orcutt & Circuit des Yeux |
20-Apr-2018 16:20 |
- |
|
|
Biorate |
20-Apr-2018 16:20 |
- |
|
|
Bob the Builder |
20-Apr-2018 16:20 |
- |
|
|
Bodyhammer |
20-Apr-2018 16:20 |
- |
|
|
Brendan Power & Michael Lempelius |
20-Apr-2018 16:20 |
- |
|
|
Broadcast The Nightmare |
20-Apr-2018 16:20 |
- |
|
|
Broken Devices |
20-Apr-2018 16:20 |
- |
|
|
Bug Nyne |
20-Apr-2018 16:20 |
- |
|
|
Campbell Kneale |
20-Apr-2018 16:20 |
- |
|
|
Cancer |
20-Apr-2018 16:20 |
- |
|
|
Carnation |
20-Apr-2018 16:20 |
- |
|
|
Cartoon Violence |
20-Apr-2018 16:20 |
- |
|
|
Cestine |
20-Apr-2018 16:20 |
- |
|
|
Charquet & Co |
20-Apr-2018 16:20 |
- |
|
|
Chris Dorman |
20-Apr-2018 16:20 |
- |
|
|
Christian Burns & Paul van Dyk |
20-Apr-2018 16:20 |
- |
|
|
Chromeo feat. Toro y Moi |
20-Apr-2018 16:20 |
- |
|
|
Cities of Sleep |
20-Apr-2018 16:20 |
- |
|
|
City Escape |
20-Apr-2018 16:20 |
- |
|
|
Connie Francis & Al Martino |
20-Apr-2018 16:20 |
- |
|
|
Cosmos |
20-Apr-2018 16:20 |
- |
|
|
Covin |
20-Apr-2018 16:20 |
- |
|
|
Crash Pad |
20-Apr-2018 16:20 |
- |
|
|
Cruz Irie Th Gltch |
20-Apr-2018 16:20 |
- |
|
|
Cuff the Duke |
20-Apr-2018 16:20 |
- |
|
|
Cyclops |
20-Apr-2018 16:20 |
- |
|
|
Danny Michel & The Benque Players |
20-Apr-2018 16:20 |
- |
|
|
Das Doors-Project |
20-Apr-2018 16:20 |
- |
|
|
David Kilgour & The Heavy Eights |
20-Apr-2018 16:20 |
- |
|
|
Definite Vākashun 4-Suckas |
20-Apr-2018 16:20 |
- |
|
|
Demi-Portion |
20-Apr-2018 16:20 |
- |
|
|
Desire |
20-Apr-2018 16:20 |
- |
|
|
Digital Cult |
20-Apr-2018 16:20 |
- |
|
|
Dilly |
20-Apr-2018 16:20 |
- |
|
|
Dollar Brand |
20-Apr-2018 16:20 |
- |
|
|
Dollar Brand with Kippie Moeketsi |
20-Apr-2018 16:20 |
- |
|
|
Don Raja |
20-Apr-2018 16:20 |
- |
|
|
Drawing Voices |
20-Apr-2018 16:20 |
- |
|
|
Drephjard |
20-Apr-2018 16:20 |
- |
|
|
Drive Me To Juliet |
20-Apr-2018 16:20 |
- |
|
|
Driving In Silence |
20-Apr-2018 16:20 |
- |
|
|
Drug Problem |
20-Apr-2018 16:20 |
- |
|
|
El Ray |
20-Apr-2018 16:20 |
- |
|
|
Electra-Combo |
20-Apr-2018 16:20 |
- |
|
|
Emerald Mind |
20-Apr-2018 16:20 |
- |
|
|
Enkindel |
20-Apr-2018 16:20 |
- |
|
|
Enzo Darren |
20-Apr-2018 16:20 |
- |
|
|
Ernst-Daniël Smid |
20-Apr-2018 16:20 |
- |
|
|
Escalivada |
20-Apr-2018 16:20 |
- |
|
|
Ever Forthright |
20-Apr-2018 16:20 |
- |
|
|
Exium & Gayle San |
20-Apr-2018 16:20 |
- |
|
|
Faye Ringel |
20-Apr-2018 16:20 |
- |
|
|
Flux |
20-Apr-2018 16:20 |
- |
|
|
Force Publique Congo |
20-Apr-2018 16:20 |
- |
|
|
Francesco Maria Veracini; John Holloway, Jaap ter Linden, Lars Ulrik Mortensen |
20-Apr-2018 16:20 |
- |
|
|
Funkytoaster |
20-Apr-2018 16:20 |
- |
|
|
GRAM |
20-Apr-2018 16:20 |
- |
|
|
Gabby Marchand |
20-Apr-2018 16:20 |
- |
|
|
Gachupin |
20-Apr-2018 16:20 |
- |
|
|
Gang War |
20-Apr-2018 16:20 |
- |
|
|
Gangrena |
20-Apr-2018 16:20 |
- |
|
|
Giants Club |
20-Apr-2018 16:20 |
- |
|
|
Glenn White |
20-Apr-2018 16:20 |
- |
|
|
Goń Charlie |
20-Apr-2018 16:20 |
- |
|
|
Grady's Hat |
20-Apr-2018 16:20 |
- |
|
|
HOLDINSIDE |
20-Apr-2018 16:20 |
- |
|
|
Hangad |
20-Apr-2018 16:20 |
- |
|
|
Helen Tartes |
20-Apr-2018 16:20 |
- |
|
|
Holly Golightly & The Brokeoffs |
20-Apr-2018 16:20 |
- |
|
|
Hollywood Killerz |
20-Apr-2018 16:20 |
- |
|
|
Horse |
20-Apr-2018 16:20 |
- |
|
|
In Blackest Velvet |
20-Apr-2018 16:20 |
- |
|
|
Inferno |
20-Apr-2018 16:20 |
- |
|
|
Insect Fear |
20-Apr-2018 16:20 |
- |
|
|
J-Train |
20-Apr-2018 16:20 |
- |
|
|
Jack Denny & His Orchestra |
20-Apr-2018 16:20 |
- |
|
|
Jakyro |
20-Apr-2018 16:20 |
- |
|
|
James Hyman |
20-Apr-2018 16:20 |
- |
|
|
Jang Hye Jin |
20-Apr-2018 16:20 |
- |
|
|
Jaymay + Kayoko |
20-Apr-2018 16:20 |
- |
|
|
Jens Lysdal |
20-Apr-2018 16:20 |
- |
|
|
Jesus Messerschmitt |
20-Apr-2018 16:20 |
- |
|
|
Joe Cocker featuring Bekka Bramlett |
20-Apr-2018 16:20 |
- |
|
|
John Grogan |
20-Apr-2018 16:20 |
- |
|
|
John Popper & The Duskray Troubadours |
20-Apr-2018 16:20 |
- |
|
|
Jon Hiseman |
20-Apr-2018 16:20 |
- |
|
|
Joren F. Nooij |
20-Apr-2018 16:20 |
- |
|
|
Jorge Vercilo |
20-Apr-2018 16:20 |
- |
|
|
Juanita du Plessis |
20-Apr-2018 16:20 |
- |
|
|
Juicy Guts |
20-Apr-2018 16:20 |
- |
|
|
Kabalas |
20-Apr-2018 16:20 |
- |
|
|
Kathleen MacInnes |
20-Apr-2018 16:20 |
- |
|
|
Kevin Quain |
20-Apr-2018 16:20 |
- |
|
|
Kiddy Contest |
20-Apr-2018 16:20 |
- |
|
|
Kiyoshi Sugo |
20-Apr-2018 16:20 |
- |
|
|
Kocab, Proudfoot, Donati, Sheehan |
20-Apr-2018 16:20 |
- |
|
|
Kode9 + Daddi Gee |
20-Apr-2018 16:20 |
- |
|
|
Kody Woah |
20-Apr-2018 16:20 |
- |
|
|
Kygo feat. Conrad |
20-Apr-2018 16:20 |
- |
|
|
La Frontera Victoriana |
20-Apr-2018 16:20 |
- |
|
|
La Tarrancha |
20-Apr-2018 16:20 |
- |
|
|
Lady and the Lost Boys |
20-Apr-2018 16:20 |
- |
|
|
Lahayna |
20-Apr-2018 16:20 |
- |
|
|
Lalo; Pierre Amoyal, Frédéric Lodéon |
20-Apr-2018 16:20 |
- |
|
|
Landon Pigg |
20-Apr-2018 16:20 |
- |
|
|
Lanemeyer |
20-Apr-2018 16:20 |
- |
|
|
Leadbelly Legacy Band |
20-Apr-2018 16:20 |
- |
|
|
League of Infinite Justice |
20-Apr-2018 16:20 |
- |
|
|
Leomia Boyd & The Gospel Music Makers |
20-Apr-2018 16:20 |
- |
|
|
Leslie Keffer ⁄ Robedoor |
20-Apr-2018 16:20 |
- |
|
|
Linda van Dyck |
20-Apr-2018 16:20 |
- |
|
|
Lou And The Hollywood Bananas |
20-Apr-2018 16:20 |
- |
|
|
Louis Prima and The Witnesses feat. Sarah Spiegel |
20-Apr-2018 16:20 |
- |
|
|
Lucien Bertolina |
20-Apr-2018 16:20 |
- |
|
|
Lucy Tentacles |
20-Apr-2018 16:20 |
- |
|
|
Luke |
20-Apr-2018 16:20 |
- |
|
|
Luv 2 Shy |
20-Apr-2018 16:20 |
- |
|
|
Madd Currency |
20-Apr-2018 16:20 |
- |
|
|
Malmen |
20-Apr-2018 16:20 |
- |
|
|
Maor Levi & M.I.K.E. |
20-Apr-2018 16:20 |
- |
|
|
Marc Bolan and T-Rex |
20-Apr-2018 16:20 |
- |
|
|
Markese |
20-Apr-2018 16:20 |
- |
|
|
Masood Ali Khan |
20-Apr-2018 16:20 |
- |
|
|
Matching Orange |
20-Apr-2018 16:20 |
- |
|
|
Matthew Bauer |
20-Apr-2018 16:20 |
- |
|
|
Mauno Meesit |
20-Apr-2018 16:20 |
- |
|
|
Mayday |
20-Apr-2018 16:20 |
- |
|
|
McGraw-Hill |
20-Apr-2018 16:20 |
- |
|
|
Meanflower |
20-Apr-2018 16:20 |
- |
|
|
Memory Machines |
20-Apr-2018 16:20 |
- |
|
|
Michael Meldrum |
20-Apr-2018 16:20 |
- |
|
|
Midwinter |
20-Apr-2018 16:20 |
- |
|
|
Mike Stuart Span |
20-Apr-2018 16:20 |
- |
|
|
Mischpoke |
20-Apr-2018 16:20 |
- |
|
|
Motivation |
20-Apr-2018 16:20 |
- |
|
|
Motorsägenservice |
20-Apr-2018 16:20 |
- |
|
|
NOSFE |
20-Apr-2018 16:20 |
- |
|
|
NY Loose |
20-Apr-2018 16:20 |
- |
|
|
Nanook of the North |
20-Apr-2018 16:20 |
- |
|
|
Nashville West |
20-Apr-2018 16:20 |
- |
|
|
Ned Kelly's Group |
20-Apr-2018 16:20 |
- |
|
|
Nelu Bălășoiu |
20-Apr-2018 16:20 |
- |
|
|
Nevchehirlian |
20-Apr-2018 16:20 |
- |
|
|
Night Conquers Day |
20-Apr-2018 16:20 |
- |
|
|
No Joy |
20-Apr-2018 16:20 |
- |
|
|
Official |
20-Apr-2018 16:20 |
- |
|
|
Oh No Not Stereo |
20-Apr-2018 16:20 |
- |
|
|
Oh! |
20-Apr-2018 16:20 |
- |
|
|
One Hundred Steps |
20-Apr-2018 16:20 |
- |
|
|
Operation Space Opera |
20-Apr-2018 16:20 |
- |
|
|
Origami Arktika & Deathprod |
20-Apr-2018 16:20 |
- |
|
|
Padd'Panik |
20-Apr-2018 16:20 |
- |
|
|
Paramount Styles |
20-Apr-2018 16:20 |
- |
|
|
Pat Shuldham-Shaw, Esme Lewis & The Choir of Hampstead Garden Suburb Junior School |
20-Apr-2018 16:20 |
- |
|
|
Paul van Dyk feat. Johnny McDaid |
20-Apr-2018 16:20 |
- |
|
|
Pauline |
20-Apr-2018 16:20 |
- |
|
|
Pet Squad |
20-Apr-2018 16:20 |
- |
|
|
Phantom 13 |
20-Apr-2018 16:20 |
- |
|
|
Planey |
20-Apr-2018 16:20 |
- |
|
|
Purveyors of Fine Funk |
20-Apr-2018 16:20 |
- |
|
|
Quartier Jazz |
20-Apr-2018 16:20 |
- |
|
|
Quintal de Clorofila |
20-Apr-2018 16:20 |
- |
|
|
Ralf Wehowsky |
20-Apr-2018 16:20 |
- |
|
|
Raw Fabrics |
20-Apr-2018 16:20 |
- |
|
|
Red Nativity |
20-Apr-2018 16:20 |
- |
|
|
Red Shoe Diaries |
20-Apr-2018 16:20 |
- |
|
|
Rein de Vries |
20-Apr-2018 16:20 |
- |
|
|
Roberto Coelho |
20-Apr-2018 16:20 |
- |
|
|
Rodolphe Burger and the Meteor Band |
20-Apr-2018 16:20 |
- |
|
|
Romantically Apocalyptic |
20-Apr-2018 16:20 |
- |
|
|
Rosina Bessie Lhévinne, Joseph Arkadievich Lhévinne |
20-Apr-2018 16:20 |
- |
|
|
Rostros Ocultos |
20-Apr-2018 16:20 |
- |
|
|
Royal Psalms |
20-Apr-2018 16:20 |
- |
|
|
Russell Scott & His Red Hots |
20-Apr-2018 16:20 |
- |
|
|
Sabachthani |
20-Apr-2018 16:20 |
- |
|
|
Sanctus Nex |
20-Apr-2018 16:20 |
- |
|
|
Scandal Featuring Lee Genesis |
20-Apr-2018 16:20 |
- |
|
|
Sean McCann & Matthew Sullivan |
20-Apr-2018 16:20 |
- |
|
|
Secret Stash |
20-Apr-2018 16:20 |
- |
|
|
Selina Martin |
20-Apr-2018 16:20 |
- |
|
|
Septithe |
20-Apr-2018 16:20 |
- |
|
|
Sequoia |
20-Apr-2018 16:20 |
- |
|
|
Shing02 and Terracotta Troops |
20-Apr-2018 16:20 |
- |
|
|
Skullblower |
20-Apr-2018 16:20 |
- |
|
|
Skydiver |
20-Apr-2018 16:20 |
- |
|
|
Solo Adultos |
20-Apr-2018 16:20 |
- |
|
|
Some Stranger |
20-Apr-2018 16:20 |
- |
|
|
Somne |
20-Apr-2018 16:20 |
- |
|
|
Stephan Bormann |
20-Apr-2018 16:20 |
- |
|
|
Stronghold |
20-Apr-2018 16:20 |
- |
|
|
Submadreamgun |
20-Apr-2018 16:20 |
- |
|
|
Subp Yao |
20-Apr-2018 16:20 |
- |
|
|
SugaRush Beat Company |
20-Apr-2018 16:20 |
- |
|
|
Sycronomica |
20-Apr-2018 16:20 |
- |
|
|
Taka Boom feat. Chaka Khan |
20-Apr-2018 16:20 |
- |
|
|
Ten Miles Wide |
20-Apr-2018 16:20 |
- |
|
|
The Alchemysts |
20-Apr-2018 16:20 |
- |
|
|
The Collins |
20-Apr-2018 16:20 |
- |
|
|
The Crazy World Of Arthur Brown |
20-Apr-2018 16:20 |
- |
|
|
The Galaxy Trio |
20-Apr-2018 16:20 |
- |
|
|
The Jazmine Ava Band |
20-Apr-2018 16:20 |
- |
|
|
The Moon Is a Disco Ball |
20-Apr-2018 16:20 |
- |
|
|
The O' Hara's |
20-Apr-2018 16:20 |
- |
|
|
The Royal Buzz |
20-Apr-2018 16:20 |
- |
|
|
The Wage of Sin |
20-Apr-2018 16:20 |
- |
|
|
The Wise Family Band |
20-Apr-2018 16:20 |
- |
|
|
Toshi Reagon |
20-Apr-2018 16:20 |
- |
|
|
Towards Atlantis Lights |
20-Apr-2018 16:20 |
- |
|
|
Tratosphere |
20-Apr-2018 16:20 |
- |
|
|
Udo Jürgens & Nationalmannschaft |
20-Apr-2018 16:20 |
- |
|
|
Unheard Before the Wake |
20-Apr-2018 16:20 |
- |
|
|
Verdict of Vengeance |
20-Apr-2018 16:20 |
- |
|
|
Vlasta Redl, Slávek Janoušek & Jaroslav Samson Lenk |
20-Apr-2018 16:20 |
- |
|
|
Vrosk |
20-Apr-2018 16:20 |
- |
|
|
Waving Corn |
20-Apr-2018 16:20 |
- |
|
|
West Hammock |
20-Apr-2018 16:20 |
- |
|
|
Wolfgang Amadeus Mozart; Werner Hollweg, Trudeliese Schmidt, Rachel Yakar, Felicity Palmer, Kurt Equiluz, Robert Tear, Simon Estes, Mozart-Orchester & Chor des Opernhauses Zürich, Nikolaus Harnoncourt |
20-Apr-2018 16:20 |
- |
|
|
Wood of Suicides |
20-Apr-2018 16:20 |
- |
|
|
Yevgeni Kissin |
20-Apr-2018 16:20 |
- |
|
|
You? Spy! |
20-Apr-2018 16:20 |
- |
|
|
Young Doe |
20-Apr-2018 16:20 |
- |
|
|
Zorrio |
20-Apr-2018 16:20 |
- |
|
|
computer dreams |
20-Apr-2018 16:20 |
- |
|
|
los pacos |
20-Apr-2018 16:20 |
- |
|
|
the Bucking Mules |
20-Apr-2018 16:20 |
- |
|
|
Жнец |
20-Apr-2018 16:20 |
- |
|
|
יעקב רוטבליט |
20-Apr-2018 16:20 |
- |
|
|
ブッチ・ウォーカーとLet's-アウトTonitesを行きます！ |
20-Apr-2018 16:20 |
- |
|
|
亂彈 |
20-Apr-2018 16:20 |
- |
|
|
|---|