![[ICO]](/icons/blank.gif) |
Name |
Last modified |
Size |
Description |
|
 |
Parent Directory |
|
- |
|
 |
A German Spectacle |
20-Apr-2018 16:20 |
- |
|
 |
ASIO ⁄ DJ HMC |
20-Apr-2018 16:20 |
- |
|
 |
Acido |
20-Apr-2018 16:20 |
- |
|
 |
Ad Nauseam |
20-Apr-2018 16:20 |
- |
|
 |
Aetheres |
20-Apr-2018 16:20 |
- |
|
 |
Ansiktet |
20-Apr-2018 16:20 |
- |
|
 |
Apes of Wrath |
20-Apr-2018 16:20 |
- |
|
 |
Ark Life |
20-Apr-2018 16:20 |
- |
|
 |
Artem Folevski |
20-Apr-2018 16:20 |
- |
|
 |
Ashbrooke All Stars |
20-Apr-2018 16:20 |
- |
|
 |
Aubrey Hodges |
20-Apr-2018 16:20 |
- |
|
 |
Aufklärung |
20-Apr-2018 16:20 |
- |
|
 |
Axwell Ingrosso |
20-Apr-2018 16:20 |
- |
|
 |
BEDlight for blueEYES |
20-Apr-2018 16:20 |
- |
|
 |
Babe, Terror |
20-Apr-2018 16:20 |
- |
|
 |
Baboon & Ceerre |
20-Apr-2018 16:20 |
- |
|
 |
Barney Wilen & Philippe Petit |
20-Apr-2018 16:20 |
- |
|
 |
Battle Axe |
20-Apr-2018 16:20 |
- |
|
 |
Beethoven; Solomon, Philharmonia Orchestra, BBC Symphony Orchestra, André Cluytens, Herbert Menges, Sir Adrian Boult |
20-Apr-2018 16:20 |
- |
|
 |
Bernadette Yao |
20-Apr-2018 16:20 |
- |
|
 |
Bernd Reheuser |
20-Apr-2018 16:20 |
- |
|
 |
Bill Orcutt & Circuit des Yeux |
20-Apr-2018 16:20 |
- |
|
 |
Biorate |
20-Apr-2018 16:20 |
- |
|
 |
Bob the Builder |
20-Apr-2018 16:20 |
- |
|
 |
Bodyhammer |
20-Apr-2018 16:20 |
- |
|
 |
Brendan Power & Michael Lempelius |
20-Apr-2018 16:20 |
- |
|
 |
Broadcast The Nightmare |
20-Apr-2018 16:20 |
- |
|
 |
Broken Devices |
20-Apr-2018 16:20 |
- |
|
 |
Bug Nyne |
20-Apr-2018 16:20 |
- |
|
 |
Campbell Kneale |
20-Apr-2018 16:20 |
- |
|
 |
Cancer |
20-Apr-2018 16:20 |
- |
|
 |
Carnation |
20-Apr-2018 16:20 |
- |
|
 |
Cartoon Violence |
20-Apr-2018 16:20 |
- |
|
 |
Cestine |
20-Apr-2018 16:20 |
- |
|
 |
Charquet & Co |
20-Apr-2018 16:20 |
- |
|
 |
Chris Dorman |
20-Apr-2018 16:20 |
- |
|
 |
Christian Burns & Paul van Dyk |
20-Apr-2018 16:20 |
- |
|
 |
Chromeo feat. Toro y Moi |
20-Apr-2018 16:20 |
- |
|
 |
Cities of Sleep |
20-Apr-2018 16:20 |
- |
|
 |
City Escape |
20-Apr-2018 16:20 |
- |
|
 |
Connie Francis & Al Martino |
20-Apr-2018 16:20 |
- |
|
 |
Cosmos |
20-Apr-2018 16:20 |
- |
|
 |
Covin |
20-Apr-2018 16:20 |
- |
|
 |
Crash Pad |
20-Apr-2018 16:20 |
- |
|
 |
Cruz Irie Th Gltch |
20-Apr-2018 16:20 |
- |
|
 |
Cuff the Duke |
20-Apr-2018 16:20 |
- |
|
 |
Cyclops |
20-Apr-2018 16:20 |
- |
|
 |
Danny Michel & The Benque Players |
20-Apr-2018 16:20 |
- |
|
 |
Das Doors-Project |
20-Apr-2018 16:20 |
- |
|
 |
David Kilgour & The Heavy Eights |
20-Apr-2018 16:20 |
- |
|
 |
Definite Vākashun 4-Suckas |
20-Apr-2018 16:20 |
- |
|
 |
Demi-Portion |
20-Apr-2018 16:20 |
- |
|
 |
Desire |
20-Apr-2018 16:20 |
- |
|
 |
Digital Cult |
20-Apr-2018 16:20 |
- |
|
 |
Dilly |
20-Apr-2018 16:20 |
- |
|
 |
Dollar Brand |
20-Apr-2018 16:20 |
- |
|
 |
Dollar Brand with Kippie Moeketsi |
20-Apr-2018 16:20 |
- |
|
 |
Don Raja |
20-Apr-2018 16:20 |
- |
|
 |
Drawing Voices |
20-Apr-2018 16:20 |
- |
|
 |
Drephjard |
20-Apr-2018 16:20 |
- |
|
 |
Drive Me To Juliet |
20-Apr-2018 16:20 |
- |
|
 |
Driving In Silence |
20-Apr-2018 16:20 |
- |
|
 |
Drug Problem |
20-Apr-2018 16:20 |
- |
|
 |
El Ray |
20-Apr-2018 16:20 |
- |
|
 |
Electra-Combo |
20-Apr-2018 16:20 |
- |
|
 |
Emerald Mind |
20-Apr-2018 16:20 |
- |
|
 |
Enkindel |
20-Apr-2018 16:20 |
- |
|
 |
Enzo Darren |
20-Apr-2018 16:20 |
- |
|
 |
Ernst-Daniël Smid |
20-Apr-2018 16:20 |
- |
|
 |
Escalivada |
20-Apr-2018 16:20 |
- |
|
 |
Ever Forthright |
20-Apr-2018 16:20 |
- |
|
 |
Exium & Gayle San |
20-Apr-2018 16:20 |
- |
|
 |
Faye Ringel |
20-Apr-2018 16:20 |
- |
|
 |
Flux |
20-Apr-2018 16:20 |
- |
|
 |
Force Publique Congo |
20-Apr-2018 16:20 |
- |
|
 |
Francesco Maria Veracini; John Holloway, Jaap ter Linden, Lars Ulrik Mortensen |
20-Apr-2018 16:20 |
- |
|
 |
Funkytoaster |
20-Apr-2018 16:20 |
- |
|
 |
GRAM |
20-Apr-2018 16:20 |
- |
|
 |
Gabby Marchand |
20-Apr-2018 16:20 |
- |
|
 |
Gachupin |
20-Apr-2018 16:20 |
- |
|
 |
Gang War |
20-Apr-2018 16:20 |
- |
|
 |
Gangrena |
20-Apr-2018 16:20 |
- |
|
 |
Giants Club |
20-Apr-2018 16:20 |
- |
|
 |
Glenn White |
20-Apr-2018 16:20 |
- |
|
 |
Goń Charlie |
20-Apr-2018 16:20 |
- |
|
 |
Grady's Hat |
20-Apr-2018 16:20 |
- |
|
 |
HOLDINSIDE |
20-Apr-2018 16:20 |
- |
|
 |
Hangad |
20-Apr-2018 16:20 |
- |
|
 |
Helen Tartes |
20-Apr-2018 16:20 |
- |
|
 |
Holly Golightly & The Brokeoffs |
20-Apr-2018 16:20 |
- |
|
 |
Hollywood Killerz |
20-Apr-2018 16:20 |
- |
|
 |
Horse |
20-Apr-2018 16:20 |
- |
|
 |
In Blackest Velvet |
20-Apr-2018 16:20 |
- |
|
 |
Inferno |
20-Apr-2018 16:20 |
- |
|
 |
Insect Fear |
20-Apr-2018 16:20 |
- |
|
 |
J-Train |
20-Apr-2018 16:20 |
- |
|
 |
Jack Denny & His Orchestra |
20-Apr-2018 16:20 |
- |
|
 |
Jakyro |
20-Apr-2018 16:20 |
- |
|
 |
James Hyman |
20-Apr-2018 16:20 |
- |
|
 |
Jang Hye Jin |
20-Apr-2018 16:20 |
- |
|
 |
Jaymay + Kayoko |
20-Apr-2018 16:20 |
- |
|
 |
Jens Lysdal |
20-Apr-2018 16:20 |
- |
|
 |
Jesus Messerschmitt |
20-Apr-2018 16:20 |
- |
|
 |
Joe Cocker featuring Bekka Bramlett |
20-Apr-2018 16:20 |
- |
|
 |
John Grogan |
20-Apr-2018 16:20 |
- |
|
 |
John Popper & The Duskray Troubadours |
20-Apr-2018 16:20 |
- |
|
 |
Jon Hiseman |
20-Apr-2018 16:20 |
- |
|
 |
Joren F. Nooij |
20-Apr-2018 16:20 |
- |
|
 |
Jorge Vercilo |
20-Apr-2018 16:20 |
- |
|
 |
Juanita du Plessis |
20-Apr-2018 16:20 |
- |
|
 |
Juicy Guts |
20-Apr-2018 16:20 |
- |
|
 |
Kabalas |
20-Apr-2018 16:20 |
- |
|
 |
Kathleen MacInnes |
20-Apr-2018 16:20 |
- |
|
 |
Kevin Quain |
20-Apr-2018 16:20 |
- |
|
 |
Kiddy Contest |
20-Apr-2018 16:20 |
- |
|
 |
Kiyoshi Sugo |
20-Apr-2018 16:20 |
- |
|
 |
Kocab, Proudfoot, Donati, Sheehan |
20-Apr-2018 16:20 |
- |
|
 |
Kode9 + Daddi Gee |
20-Apr-2018 16:20 |
- |
|
 |
Kody Woah |
20-Apr-2018 16:20 |
- |
|
 |
Kygo feat. Conrad |
20-Apr-2018 16:20 |
- |
|
 |
La Frontera Victoriana |
20-Apr-2018 16:20 |
- |
|
 |
La Tarrancha |
20-Apr-2018 16:20 |
- |
|
 |
Lady and the Lost Boys |
20-Apr-2018 16:20 |
- |
|
 |
Lahayna |
20-Apr-2018 16:20 |
- |
|
 |
Lalo; Pierre Amoyal, Frédéric Lodéon |
20-Apr-2018 16:20 |
- |
|
 |
Landon Pigg |
20-Apr-2018 16:20 |
- |
|
 |
Lanemeyer |
20-Apr-2018 16:20 |
- |
|
 |
Leadbelly Legacy Band |
20-Apr-2018 16:20 |
- |
|
 |
League of Infinite Justice |
20-Apr-2018 16:20 |
- |
|
 |
Leomia Boyd & The Gospel Music Makers |
20-Apr-2018 16:20 |
- |
|
 |
Leslie Keffer ⁄ Robedoor |
20-Apr-2018 16:20 |
- |
|
 |
Linda van Dyck |
20-Apr-2018 16:20 |
- |
|
 |
Lou And The Hollywood Bananas |
20-Apr-2018 16:20 |
- |
|
 |
Louis Prima and The Witnesses feat. Sarah Spiegel |
20-Apr-2018 16:20 |
- |
|
 |
Lucien Bertolina |
20-Apr-2018 16:20 |
- |
|
 |
Lucy Tentacles |
20-Apr-2018 16:20 |
- |
|
 |
Luke |
20-Apr-2018 16:20 |
- |
|
 |
Luv 2 Shy |
20-Apr-2018 16:20 |
- |
|
 |
Madd Currency |
20-Apr-2018 16:20 |
- |
|
 |
Malmen |
20-Apr-2018 16:20 |
- |
|
 |
Maor Levi & M.I.K.E. |
20-Apr-2018 16:20 |
- |
|
 |
Marc Bolan and T-Rex |
20-Apr-2018 16:20 |
- |
|
 |
Markese |
20-Apr-2018 16:20 |
- |
|
 |
Masood Ali Khan |
20-Apr-2018 16:20 |
- |
|
 |
Matching Orange |
20-Apr-2018 16:20 |
- |
|
 |
Matthew Bauer |
20-Apr-2018 16:20 |
- |
|
 |
Mauno Meesit |
20-Apr-2018 16:20 |
- |
|
 |
Mayday |
20-Apr-2018 16:20 |
- |
|
 |
McGraw-Hill |
20-Apr-2018 16:20 |
- |
|
 |
Meanflower |
20-Apr-2018 16:20 |
- |
|
 |
Memory Machines |
20-Apr-2018 16:20 |
- |
|
 |
Michael Meldrum |
20-Apr-2018 16:20 |
- |
|
 |
Midwinter |
20-Apr-2018 16:20 |
- |
|
 |
Mike Stuart Span |
20-Apr-2018 16:20 |
- |
|
 |
Mischpoke |
20-Apr-2018 16:20 |
- |
|
 |
Motivation |
20-Apr-2018 16:20 |
- |
|
 |
Motorsägenservice |
20-Apr-2018 16:20 |
- |
|
 |
NOSFE |
20-Apr-2018 16:20 |
- |
|
 |
NY Loose |
20-Apr-2018 16:20 |
- |
|
 |
Nanook of the North |
20-Apr-2018 16:20 |
- |
|
 |
Nashville West |
20-Apr-2018 16:20 |
- |
|
 |
Ned Kelly's Group |
20-Apr-2018 16:20 |
- |
|
 |
Nelu Bălășoiu |
20-Apr-2018 16:20 |
- |
|
 |
Nevchehirlian |
20-Apr-2018 16:20 |
- |
|
 |
Night Conquers Day |
20-Apr-2018 16:20 |
- |
|
 |
No Joy |
20-Apr-2018 16:20 |
- |
|
 |
Official |
20-Apr-2018 16:20 |
- |
|
 |
Oh No Not Stereo |
20-Apr-2018 16:20 |
- |
|
 |
Oh! |
20-Apr-2018 16:20 |
- |
|
 |
One Hundred Steps |
20-Apr-2018 16:20 |
- |
|
 |
Operation Space Opera |
20-Apr-2018 16:20 |
- |
|
 |
Origami Arktika & Deathprod |
20-Apr-2018 16:20 |
- |
|
 |
Padd'Panik |
20-Apr-2018 16:20 |
- |
|
 |
Paramount Styles |
20-Apr-2018 16:20 |
- |
|
 |
Pat Shuldham-Shaw, Esme Lewis & The Choir of Hampstead Garden Suburb Junior School |
20-Apr-2018 16:20 |
- |
|
 |
Paul van Dyk feat. Johnny McDaid |
20-Apr-2018 16:20 |
- |
|
 |
Pauline |
20-Apr-2018 16:20 |
- |
|
 |
Pet Squad |
20-Apr-2018 16:20 |
- |
|
 |
Phantom 13 |
20-Apr-2018 16:20 |
- |
|
 |
Planey |
20-Apr-2018 16:20 |
- |
|
 |
Purveyors of Fine Funk |
20-Apr-2018 16:20 |
- |
|
 |
Quartier Jazz |
20-Apr-2018 16:20 |
- |
|
 |
Quintal de Clorofila |
20-Apr-2018 16:20 |
- |
|
 |
Ralf Wehowsky |
20-Apr-2018 16:20 |
- |
|
 |
Raw Fabrics |
20-Apr-2018 16:20 |
- |
|
 |
Red Nativity |
20-Apr-2018 16:20 |
- |
|
 |
Red Shoe Diaries |
20-Apr-2018 16:20 |
- |
|
 |
Rein de Vries |
20-Apr-2018 16:20 |
- |
|
 |
Roberto Coelho |
20-Apr-2018 16:20 |
- |
|
 |
Rodolphe Burger and the Meteor Band |
20-Apr-2018 16:20 |
- |
|
 |
Romantically Apocalyptic |
20-Apr-2018 16:20 |
- |
|
 |
Rosina Bessie Lhévinne, Joseph Arkadievich Lhévinne |
20-Apr-2018 16:20 |
- |
|
 |
Rostros Ocultos |
20-Apr-2018 16:20 |
- |
|
 |
Royal Psalms |
20-Apr-2018 16:20 |
- |
|
 |
Russell Scott & His Red Hots |
20-Apr-2018 16:20 |
- |
|
 |
Sabachthani |
20-Apr-2018 16:20 |
- |
|
 |
Sanctus Nex |
20-Apr-2018 16:20 |
- |
|
 |
Scandal Featuring Lee Genesis |
20-Apr-2018 16:20 |
- |
|
 |
Sean McCann & Matthew Sullivan |
20-Apr-2018 16:20 |
- |
|
 |
Secret Stash |
20-Apr-2018 16:20 |
- |
|
 |
Selina Martin |
20-Apr-2018 16:20 |
- |
|
 |
Septithe |
20-Apr-2018 16:20 |
- |
|
 |
Sequoia |
20-Apr-2018 16:20 |
- |
|
 |
Shing02 and Terracotta Troops |
20-Apr-2018 16:20 |
- |
|
 |
Skullblower |
20-Apr-2018 16:20 |
- |
|
 |
Skydiver |
20-Apr-2018 16:20 |
- |
|
 |
Solo Adultos |
20-Apr-2018 16:20 |
- |
|
 |
Some Stranger |
20-Apr-2018 16:20 |
- |
|
 |
Somne |
20-Apr-2018 16:20 |
- |
|
 |
Stephan Bormann |
20-Apr-2018 16:20 |
- |
|
 |
Stronghold |
20-Apr-2018 16:20 |
- |
|
 |
Submadreamgun |
20-Apr-2018 16:20 |
- |
|
 |
Subp Yao |
20-Apr-2018 16:20 |
- |
|
 |
SugaRush Beat Company |
20-Apr-2018 16:20 |
- |
|
 |
Sycronomica |
20-Apr-2018 16:20 |
- |
|
 |
Taka Boom feat. Chaka Khan |
20-Apr-2018 16:20 |
- |
|
 |
Ten Miles Wide |
20-Apr-2018 16:20 |
- |
|
 |
The Alchemysts |
20-Apr-2018 16:20 |
- |
|
 |
The Collins |
20-Apr-2018 16:20 |
- |
|
 |
The Crazy World Of Arthur Brown |
20-Apr-2018 16:20 |
- |
|
 |
The Galaxy Trio |
20-Apr-2018 16:20 |
- |
|
 |
The Jazmine Ava Band |
20-Apr-2018 16:20 |
- |
|
 |
The Moon Is a Disco Ball |
20-Apr-2018 16:20 |
- |
|
 |
The O' Hara's |
20-Apr-2018 16:20 |
- |
|
 |
The Royal Buzz |
20-Apr-2018 16:20 |
- |
|
 |
The Wage of Sin |
20-Apr-2018 16:20 |
- |
|
 |
The Wise Family Band |
20-Apr-2018 16:20 |
- |
|
 |
Toshi Reagon |
20-Apr-2018 16:20 |
- |
|
 |
Towards Atlantis Lights |
20-Apr-2018 16:20 |
- |
|
 |
Tratosphere |
20-Apr-2018 16:20 |
- |
|
 |
Udo Jürgens & Nationalmannschaft |
20-Apr-2018 16:20 |
- |
|
 |
Unheard Before the Wake |
20-Apr-2018 16:20 |
- |
|
 |
Verdict of Vengeance |
20-Apr-2018 16:20 |
- |
|
 |
Vlasta Redl, Slávek Janoušek & Jaroslav Samson Lenk |
20-Apr-2018 16:20 |
- |
|
 |
Vrosk |
20-Apr-2018 16:20 |
- |
|
 |
Waving Corn |
20-Apr-2018 16:20 |
- |
|
 |
West Hammock |
20-Apr-2018 16:20 |
- |
|
 |
Wolfgang Amadeus Mozart; Werner Hollweg, Trudeliese Schmidt, Rachel Yakar, Felicity Palmer, Kurt Equiluz, Robert Tear, Simon Estes, Mozart-Orchester & Chor des Opernhauses Zürich, Nikolaus Harnoncourt |
20-Apr-2018 16:20 |
- |
|
 |
Wood of Suicides |
20-Apr-2018 16:20 |
- |
|
 |
Yevgeni Kissin |
20-Apr-2018 16:20 |
- |
|
 |
You? Spy! |
20-Apr-2018 16:20 |
- |
|
 |
Young Doe |
20-Apr-2018 16:20 |
- |
|
 |
Zorrio |
20-Apr-2018 16:20 |
- |
|
 |
computer dreams |
20-Apr-2018 16:20 |
- |
|
 |
los pacos |
20-Apr-2018 16:20 |
- |
|
 |
the Bucking Mules |
20-Apr-2018 16:20 |
- |
|
 |
Жнец |
20-Apr-2018 16:20 |
- |
|
 |
יעקב רוטבליט |
20-Apr-2018 16:20 |
- |
|
 |
ブッチ・ウォーカーとLet's-アウトTonitesを行きます! |
20-Apr-2018 16:20 |
- |
|
 |
亂彈 |
20-Apr-2018 16:20 |
- |
|
|